C23H17Cl2N5O3S — CID 17176944
5-(3,4-dichlorophenyl)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]furan-2-carboxamide (PubChem CID 17176944) has the molecular formula C23H17Cl2N5O3S and a molecular weight of 514.39 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]furan-2-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17176944 |
| Molecular Formula | C23H17Cl2N5O3S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-[5-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-2-methoxyphenyl]furan-2-carboxamide |
| SMILES | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)c4ccc(-c5ccc(Cl)c(Cl)c5)o4)c3)nn12 |
| InChI | InChI=1S/C23H17Cl2N5O3S/c1-3-20-27-28-23-30(20)29-22(34-23)13-5-7-18(32-2)16(11-13)26-21(31)19-9-8-17(33-19)12-4-6-14(24)15(25)10-12/h4-11H,3H2,1-2H3,(H,26,31) |
| InChIKey | KILBQRQZQIHWQE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |