C18H11Cl2NO5 — CID 28669924
4-[[5-(3,4-dichlorophenyl)furan-2-carbonyl]amino]-2-hydroxybenzoic acid (PubChem CID 28669924) has the molecular formula C18H11Cl2NO5 and a molecular weight of 392.19 g/mol. Its IUPAC name is 4-[[5-(3,4-dichlorophenyl)furan-2-carbonyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[5-(3,4-dichlorophenyl)furan-2-carbonyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 28669924 |
| Molecular Formula | C18H11Cl2NO5 |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 4-[[5-(3,4-dichlorophenyl)furan-2-carbonyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(O)c1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C18H11Cl2NO5/c19-12-4-1-9(7-13(12)20)15-5-6-16(26-15)17(23)21-10-2-3-11(18(24)25)14(22)8-10/h1-8,22H,(H,21,23)(H,24,25) |
| InChIKey | BOBSCFXKKRIACU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |