C12H14N6O2S — CID 953658
N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-phenoxyacetamide (PubChem CID 953658) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 953658 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-[(2-ethyltetrazol-5-yl)carbamothioyl]-2-phenoxyacetamide |
| SMILES | CCn1nnc(NC(=S)NC(=O)COc2ccccc2)n1 |
| InChI | InChI=1S/C12H14N6O2S/c1-2-18-16-11(15-17-18)14-12(21)13-10(19)8-20-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,13,14,16,19,21) |
| InChIKey | LGNQPWAFULRVOP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|