C11H9ClN6O3 — CID 953418
(E)-3-(4-chloro-3-nitrophenyl)-N-(2-methyltetrazol-5-yl)prop-2-enamide (PubChem CID 953418) has the molecular formula C11H9ClN6O3 and a molecular weight of 308.69 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-nitrophenyl)-N-(2-methyltetrazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-3-nitrophenyl)-N-(2-methyltetrazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 953418 |
| Molecular Formula | C11H9ClN6O3 |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (E)-3-(4-chloro-3-nitrophenyl)-N-(2-methyltetrazol-5-yl)prop-2-enamide |
| SMILES | Cn1nnc(NC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H9ClN6O3/c1-17-15-11(14-16-17)13-10(19)5-3-7-2-4-8(12)9(6-7)18(20)21/h2-6H,1H3,(H,13,15,19)/b5-3+ |
| InChIKey | AMAHFERIRMBYNR-HWKANZROSA-N |
| XLogP | 1.42 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|