C26H25N3O6S — CID 6216613
4-methyl-N-[4-[(E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoyl]phenyl]benzenesulfonamide (PubChem CID 6216613) has the molecular formula C26H25N3O6S and a molecular weight of 507.57 g/mol. Its IUPAC name is 4-methyl-N-[4-[(E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-[(E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6216613 |
| Molecular Formula | C26H25N3O6S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-methyl-N-[4-[(E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)/C=C/c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O6S/c1-19-2-10-23(11-3-19)36(33,34)27-22-8-6-21(7-9-22)26(30)13-5-20-4-12-24(25(18-20)29(31)32)28-14-16-35-17-15-28/h2-13,18,27H,14-17H2,1H3/b13-5+ |
| InChIKey | CSGHLXOEHWGULX-WLRTZDKTSA-N |
| XLogP | 4.44 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|