C21H23N3O6 — CID 7780805
[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 7780805) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7780805 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)OC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H23N3O6/c1-14-3-6-17(7-4-14)22-20(25)15(2)30-21(26)16-5-8-18(19(13-16)24(27)28)23-9-11-29-12-10-23/h3-8,13,15H,9-12H2,1-2H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | NCUOVZSRGMBMLA-OAHLLOKOSA-N |
| XLogP | 2.92 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|