C27H26N2O6 — CID 26861335
[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate (PubChem CID 26861335) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate.
| Compound Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 26861335 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-morpholin-4-yl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)[C@H](OC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O6/c1-18-3-7-20(8-4-18)25(30)26(21-9-5-19(2)6-10-21)35-27(31)22-11-12-23(24(17-22)29(32)33)28-13-15-34-16-14-28/h3-12,17,26H,13-16H2,1-2H3/t26-/m1/s1 |
| InChIKey | ATXGONRDNPKXOE-AREMUKBSSA-N |
| XLogP | 4.83 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|