C22H29N3O8 — CID 42901931
ethyl 1-[2-(4-morpholin-4-yl-3-nitrobenzoyl)oxypropanoyl]piperidine-4-carboxylate (PubChem CID 42901931) has the molecular formula C22H29N3O8 and a molecular weight of 463.49 g/mol. Its IUPAC name is ethyl 1-[2-(4-morpholin-4-yl-3-nitrobenzoyl)oxypropanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-morpholin-4-yl-3-nitrobenzoyl)oxypropanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42901931 |
| Molecular Formula | C22H29N3O8 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | ethyl 1-[2-(4-morpholin-4-yl-3-nitrobenzoyl)oxypropanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)OC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H29N3O8/c1-3-32-21(27)16-6-8-24(9-7-16)20(26)15(2)33-22(28)17-4-5-18(19(14-17)25(29)30)23-10-12-31-13-11-23/h4-5,14-16H,3,6-13H2,1-2H3 |
| InChIKey | MAMWPLRRENSCCU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|