C9H9Cl3N2O — CID 169369479
2-chloro-N'-(2,5-dichloro-4-methoxyphenyl)ethanimidamide (PubChem CID 169369479) has the molecular formula C9H9Cl3N2O and a molecular weight of 267.54 g/mol. Its IUPAC name is 2-chloro-N'-(2,5-dichloro-4-methoxyphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,5-dichloro-4-methoxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169369479 |
| Molecular Formula | C9H9Cl3N2O |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 2-chloro-N'-(2,5-dichloro-4-methoxyphenyl)ethanimidamide |
| SMILES | COc1cc(Cl)c(/N=C(/N)CCl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3N2O/c1-15-8-3-5(11)7(2-6(8)12)14-9(13)4-10/h2-3H,4H2,1H3,(H2,13,14) |
| InChIKey | ZIDFTBDTODOCBG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|