C17H18ClN3O3 — CID 169369448
2-[(1-amino-2-chloroethylidene)amino]-N-(3,4-dimethoxyphenyl)benzamide (PubChem CID 169369448) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-[(1-amino-2-chloroethylidene)amino]-N-(3,4-dimethoxyphenyl)benzamide.
| Compound Name | 2-[(1-amino-2-chloroethylidene)amino]-N-(3,4-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 169369448 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[(1-amino-2-chloroethylidene)amino]-N-(3,4-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2/N=C(/N)CCl)cc1OC |
| InChI | InChI=1S/C17H18ClN3O3/c1-23-14-8-7-11(9-15(14)24-2)20-17(22)12-5-3-4-6-13(12)21-16(19)10-18/h3-9H,10H2,1-2H3,(H2,19,21)(H,20,22) |
| InChIKey | SXGKSSSPOHFGJD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|