C17H18ClN5O2S — CID 169368849
1-[[2-[(1-amino-2-chloroethylidene)amino]benzoyl]amino]-3-(4-methoxyphenyl)thiourea (PubChem CID 169368849) has the molecular formula C17H18ClN5O2S and a molecular weight of 391.88 g/mol. Its IUPAC name is 1-[[2-[(1-amino-2-chloroethylidene)amino]benzoyl]amino]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[[2-[(1-amino-2-chloroethylidene)amino]benzoyl]amino]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 169368849 |
| Molecular Formula | C17H18ClN5O2S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-[[2-[(1-amino-2-chloroethylidene)amino]benzoyl]amino]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)c2ccccc2/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C17H18ClN5O2S/c1-25-12-8-6-11(7-9-12)20-17(26)23-22-16(24)13-4-2-3-5-14(13)21-15(19)10-18/h2-9H,10H2,1H3,(H2,19,21)(H,22,24)(H2,20,23,26) |
| InChIKey | XKZGMOPHJPEPKA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|