C18H17N5O3S — CID 168523506
2-cyano-N-[2-[[(4-methoxyphenyl)carbamothioylamino]carbamoyl]phenyl]acetamide (PubChem CID 168523506) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-cyano-N-[2-[[(4-methoxyphenyl)carbamothioylamino]carbamoyl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[2-[[(4-methoxyphenyl)carbamothioylamino]carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 168523506 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-cyano-N-[2-[[(4-methoxyphenyl)carbamothioylamino]carbamoyl]phenyl]acetamide |
| SMILES | COc1ccc(NC(=S)NNC(=O)c2ccccc2NC(=O)CC#N)cc1 |
| InChI | InChI=1S/C18H17N5O3S/c1-26-13-8-6-12(7-9-13)20-18(27)23-22-17(25)14-4-2-3-5-15(14)21-16(24)10-11-19/h2-9H,10H2,1H3,(H,21,24)(H,22,25)(H2,20,23,27) |
| InChIKey | RBSNXRZHURAWCG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|