C17H15N5O3 — CID 168523939
2-cyano-N-[2-[(phenylcarbamoylamino)carbamoyl]phenyl]acetamide (PubChem CID 168523939) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-cyano-N-[2-[(phenylcarbamoylamino)carbamoyl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[2-[(phenylcarbamoylamino)carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 168523939 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-cyano-N-[2-[(phenylcarbamoylamino)carbamoyl]phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccccc1C(=O)NNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H15N5O3/c18-11-10-15(23)20-14-9-5-4-8-13(14)16(24)21-22-17(25)19-12-6-2-1-3-7-12/h1-9H,10H2,(H,20,23)(H,21,24)(H2,19,22,25) |
| InChIKey | ATVZRBGBGXPRKE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|