C10H11ClN4O2 — CID 169368516
2-chloro-N'-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanimidamide (PubChem CID 169368516) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is 2-chloro-N'-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanimidamide.
| Compound Name | 2-chloro-N'-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanimidamide |
|---|---|
| PubChem CID | 169368516 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-chloro-N'-(6-methoxy-2-oxo-1,3-dihydrobenzimidazol-5-yl)ethanimidamide |
| SMILES | COc1cc2[nH]c(=O)[nH]c2cc1/N=C(/N)CCl |
| InChI | InChI=1S/C10H11ClN4O2/c1-17-8-3-6-5(14-10(16)15-6)2-7(8)13-9(12)4-11/h2-3H,4H2,1H3,(H2,12,13)(H2,14,15,16) |
| InChIKey | WJMJIBOXWJQTKB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|