C15H18ClN3O4 — CID 14293798
ethyl 2-[(Z)-(1-amino-2-chloroethylidene)amino]-5,6-dimethoxy-1H-indole-3-carboxylate (PubChem CID 14293798) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is ethyl 2-[(Z)-(1-amino-2-chloroethylidene)amino]-5,6-dimethoxy-1H-indole-3-carboxylate.
| Compound Name | ethyl 2-[(Z)-(1-amino-2-chloroethylidene)amino]-5,6-dimethoxy-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 14293798 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | ethyl 2-[(Z)-(1-amino-2-chloroethylidene)amino]-5,6-dimethoxy-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(/N=C(\N)CCl)[nH]c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C15H18ClN3O4/c1-4-23-15(20)13-8-5-10(21-2)11(22-3)6-9(8)18-14(13)19-12(17)7-16/h5-6,18H,4,7H2,1-3H3,(H2,17,19) |
| InChIKey | YEFYMMLMYBNMCG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|