C18H18ClNO6 — CID 15406018
methyl 2-[(4-chlorobenzoyl)amino]-3,4,5-trimethoxybenzoate (PubChem CID 15406018) has the molecular formula C18H18ClNO6 and a molecular weight of 379.80 g/mol. Its IUPAC name is methyl 2-[(4-chlorobenzoyl)amino]-3,4,5-trimethoxybenzoate.
| Compound Name | methyl 2-[(4-chlorobenzoyl)amino]-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 15406018 |
| Molecular Formula | C18H18ClNO6 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | methyl 2-[(4-chlorobenzoyl)amino]-3,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO6/c1-23-13-9-12(18(22)26-4)14(16(25-3)15(13)24-2)20-17(21)10-5-7-11(19)8-6-10/h5-9H,1-4H3,(H,20,21) |
| InChIKey | HVZWWZANZIMOKD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |