C17H17Cl2NO7S — CID 2799262
methyl 2-[(3,5-dichlorophenyl)sulfonylamino]-3,4,5-trimethoxybenzoate (PubChem CID 2799262) has the molecular formula C17H17Cl2NO7S and a molecular weight of 450.30 g/mol. Its IUPAC name is methyl 2-[(3,5-dichlorophenyl)sulfonylamino]-3,4,5-trimethoxybenzoate.
| Compound Name | methyl 2-[(3,5-dichlorophenyl)sulfonylamino]-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2799262 |
| Molecular Formula | C17H17Cl2NO7S |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | methyl 2-[(3,5-dichlorophenyl)sulfonylamino]-3,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO7S/c1-24-13-8-12(17(21)27-4)14(16(26-3)15(13)25-2)20-28(22,23)11-6-9(18)5-10(19)7-11/h5-8,20H,1-4H3 |
| InChIKey | NCPOQTLBKTUOJF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |