C46H30F6N6O2 — CID 135909459
10,20-diphenyl-5-N,15-N-bis[2-(trifluoromethoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine (PubChem CID 135909459) has the molecular formula C46H30F6N6O2 and a molecular weight of 812.77 g/mol. Its IUPAC name is 10,20-diphenyl-5-N,15-N-bis[2-(trifluoromethoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine.
| Compound Name | 10,20-diphenyl-5-N,15-N-bis[2-(trifluoromethoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine |
|---|---|
| PubChem CID | 135909459 |
| Molecular Formula | C46H30F6N6O2 |
| Molecular Weight | 812.77 g/mol |
| Exact Mass | 812.23 |
| IUPAC Name | 10,20-diphenyl-5-N,15-N-bis[2-(trifluoromethoxy)phenyl]-21,23-dihydroporphyrin-5,15-diamine |
| SMILES | FC(F)(F)Oc1ccccc1Nc1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(Nc3ccccc3OC(F)(F)F)c3nc(c(-c4ccccc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C46H30F6N6O2/c47-45(48,49)59-39-17-9-7-15-29(39)57-43-35-23-19-31(53-35)41(27-11-3-1-4-12-27)32-20-24-36(54-32)44(58-30-16-8-10-18-40(30)60-46(50,51)52)38-26-22-34(56-38)42(28-13-5-2-6-14-28)33-21-25-37(43)55-33/h1-26,53,56-58H/b41-31-,41-32-,42-33-,42-34-,43-35+,43-37+,44-36+,44-38+ |
| InChIKey | GPQJUQDYPYLQTM-CAEQTRJMSA-N |
| XLogP | 13.27 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.77 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |