C46H38N4O — CID 132530319
24,26-dimethyl-6,15,20-tris(4-methylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene (PubChem CID 132530319) has the molecular formula C46H38N4O and a molecular weight of 662.84 g/mol. Its IUPAC name is 24,26-dimethyl-6,15,20-tris(4-methylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene.
| Compound Name | 24,26-dimethyl-6,15,20-tris(4-methylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 132530319 |
| Molecular Formula | C46H38N4O |
| Molecular Weight | 662.84 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | 24,26-dimethyl-6,15,20-tris(4-methylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene |
| SMILES | Cc1ccc(-c2c3nc(c4ccc(c(-c5ccc(C)cc5)c5ccc(o5)c(-c5ccc(C)cc5)c5ccc(c6ccc2[nH]6)n5C)n4C)C=C3)cc1 |
| InChI | InChI=1S/C46H38N4O/c1-28-6-12-31(13-7-28)44-36-20-18-34(47-36)38-22-24-40(49(38)4)45(32-14-8-29(2)9-15-32)42-26-27-43(51-42)46(33-16-10-30(3)11-17-33)41-25-23-39(50(41)5)35-19-21-37(44)48-35/h6-27,47H,1-5H3/b38-34-,39-35-,44-36-,44-37-,45-40-,45-42-,46-41-,46-43- |
| InChIKey | LOJKMIPZJBZXQJ-XMPPAASUSA-N |
| XLogP | 11.95 |
| TPSA | 51.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.84 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |