C44H39N7 — CID 11679135
10-[4-(azidomethyl)phenyl]-5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin (PubChem CID 11679135) has the molecular formula C44H39N7 and a molecular weight of 665.84 g/mol. Its IUPAC name is 10-[4-(azidomethyl)phenyl]-5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin.
| Compound Name | 10-[4-(azidomethyl)phenyl]-5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin |
|---|---|
| PubChem CID | 11679135 |
| Molecular Formula | C44H39N7 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.33 |
| IUPAC Name | 10-[4-(azidomethyl)phenyl]-5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4ccc(CN=[N+]=[N-])cc4)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c4ccc2[nH]4)C=C3)c(C)c1 |
| InChI | InChI=1S/C44H39N7/c1-24-19-26(3)40(27(4)20-24)43-36-13-11-32(47-36)33-12-14-37(48-33)44(41-28(5)21-25(2)22-29(41)6)39-18-16-35(50-39)42(34-15-17-38(43)49-34)31-9-7-30(8-10-31)23-46-51-45/h7-22,47-49H,23H2,1-6H3/b33-32-,42-34-,42-35-,43-36+,43-38+,44-37+,44-39+ |
| InChIKey | YAIIDSOXBMLAIC-PSVXPXDJSA-N |
| XLogP | 12.36 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|