C52H44N4 — CID 11411742
10,20-bis(4-methylphenyl)-5-(4-prop-2-enylphenyl)-15-(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 11411742) has the molecular formula C52H44N4 and a molecular weight of 724.95 g/mol. Its IUPAC name is 10,20-bis(4-methylphenyl)-5-(4-prop-2-enylphenyl)-15-(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 10,20-bis(4-methylphenyl)-5-(4-prop-2-enylphenyl)-15-(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11411742 |
| Molecular Formula | C52H44N4 |
| Molecular Weight | 724.95 g/mol |
| Exact Mass | 724.36 |
| IUPAC Name | 10,20-bis(4-methylphenyl)-5-(4-prop-2-enylphenyl)-15-(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | C=CCc1ccc(-c2c3ccc([nH]3)c(-c3ccc(C)cc3)c3nc(c(-c4c(C)cc(C)cc4C)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H44N4/c1-7-8-36-13-19-39(20-14-36)51-42-23-21-40(53-42)49(37-15-9-31(2)10-16-37)44-25-27-46(55-44)52(48-34(5)29-33(4)30-35(48)6)47-28-26-45(56-47)50(41-22-24-43(51)54-41)38-17-11-32(3)12-18-38/h7,9-30,53-54H,1,8H2,2-6H3/b49-40-,49-44-,50-41-,50-45-,51-42-,51-43-,52-46+,52-47+ |
| InChIKey | VHUBDDNIVTUIQD-KECZYOECSA-N |
| XLogP | 13.59 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.95 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|