C40H30N2S2 — CID 46846032
6,11,16-tris(4-methylphenyl)-20,22-dithia-21,23-diazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5,7,9,11,13,15(21),16,18-decaene (PubChem CID 46846032) has the molecular formula C40H30N2S2 and a molecular weight of 602.83 g/mol. Its IUPAC name is 6,11,16-tris(4-methylphenyl)-20,22-dithia-21,23-diazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5,7,9,11,13,15(21),16,18-decaene.
| Compound Name | 6,11,16-tris(4-methylphenyl)-20,22-dithia-21,23-diazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5,7,9,11,13,15(21),16,18-decaene |
|---|---|
| PubChem CID | 46846032 |
| Molecular Formula | C40H30N2S2 |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 6,11,16-tris(4-methylphenyl)-20,22-dithia-21,23-diazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5,7,9,11,13,15(21),16,18-decaene |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc(s4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4ccc2s4)C=C3)cc1 |
| InChI | InChI=1S/C40H30N2S2/c1-24-4-10-27(11-5-24)38-31-17-16-30(41-31)34-20-21-35(43-34)39(28-12-6-25(2)7-13-28)32-18-19-33(42-32)40(37-23-22-36(38)44-37)29-14-8-26(3)9-15-29/h4-23,41H,1-3H3/b34-30-,38-31-,38-36-,39-32-,39-35-,40-33-,40-37- |
| InChIKey | FDGOLGHXGKLWTO-KLDJULDBSA-N |
| XLogP | 12.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |