C48H42N5OPtS+3 — CID 135454674
(dimethyl-λ4-sulfanylidene)oxidanium;platinum(2+);5,10,15-tris(4-methylphenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 135454674) has the molecular formula C48H42N5OPtS+3 and a molecular weight of 932.04 g/mol. Its IUPAC name is (dimethyl-λ4-sulfanylidene)oxidanium;platinum(2+);5,10,15-tris(4-methylphenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | (dimethyl-λ4-sulfanylidene)oxidanium;platinum(2+);5,10,15-tris(4-methylphenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135454674 |
| Molecular Formula | C48H42N5OPtS+3 |
| Molecular Weight | 932.04 g/mol |
| Exact Mass | 931.27 |
| IUPAC Name | (dimethyl-λ4-sulfanylidene)oxidanium;platinum(2+);5,10,15-tris(4-methylphenyl)-20-pyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[H][O+]=S(C)C.[Pt+2] |
| InChI | InChI=1S/C46H35N5.C2H6OS.Pt/c1-28-4-10-31(11-5-28)43-35-16-18-37(48-35)44(32-12-6-29(2)7-13-32)39-20-22-41(50-39)46(34-24-26-47-27-25-34)42-23-21-40(51-42)45(38-19-17-36(43)49-38)33-14-8-30(3)9-15-33;1-4(2)3;/h4-27,48,51H,1-3H3;1-2H3;/q;;+2/p+1/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42-;; |
| InChIKey | IKROUISRVDGAJT-NPOFMVBCSA-O |
| XLogP | 11.79 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.04 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|