C47H35N5 — CID 135467968
5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-pyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 135467968) has the molecular formula C47H35N5 and a molecular weight of 669.83 g/mol. Its IUPAC name is 5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-pyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-pyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135467968 |
| Molecular Formula | C47H35N5 |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | 5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-pyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | C=Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccncc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H35N5/c1-4-31-9-15-34(16-10-31)46-40-19-17-36(49-40)44(32-11-5-29(2)6-12-32)38-21-23-42(51-38)47(35-25-27-48-28-26-35)43-24-22-39(52-43)45(37-18-20-41(46)50-37)33-13-7-30(3)8-14-33/h4-28,49,52H,1H2,2-3H3/b44-36-,44-38-,45-37-,45-39-,46-40-,46-41-,47-42-,47-43- |
| InChIKey | JLCUURVOGHQDDZ-ZSNRFELISA-N |
| XLogP | 11.98 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |