C46H35N5 — CID 11527545
5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-(1H-pyrrol-2-yl)-21,22-dihydroporphyrin (PubChem CID 11527545) has the molecular formula C46H35N5 and a molecular weight of 657.82 g/mol. Its IUPAC name is 5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-(1H-pyrrol-2-yl)-21,22-dihydroporphyrin.
| Compound Name | 5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-(1H-pyrrol-2-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11527545 |
| Molecular Formula | C46H35N5 |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | 5-(4-ethenylphenyl)-10,20-bis(4-methylphenyl)-15-(1H-pyrrol-2-yl)-21,22-dihydroporphyrin |
| SMILES | C=Cc1ccc(-c2c3ccc([nH]3)c(-c3ccc(C)cc3)c3nc(c(-c4ccc[nH]4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H35N5/c1-4-30-11-17-33(18-12-30)45-37-21-19-35(48-37)43(31-13-7-28(2)8-14-31)39-23-25-41(50-39)46(34-6-5-27-47-34)42-26-24-40(51-42)44(36-20-22-38(45)49-36)32-15-9-29(3)10-16-32/h4-27,47-49H,1H2,2-3H3/b43-35-,43-39-,44-36-,44-40-,45-37-,45-38-,46-41-,46-42- |
| InChIKey | SSHULPPHOKBPKE-DJGOHHOHSA-N |
| XLogP | 11.91 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |