C48H41Cl2N5OPtS — CID 15793969
dichloroplatinum;methylsulfinylmethane;5,10,20-tris(4-methylphenyl)-15-pyridin-4-yl-21,22-dihydroporphyrin (PubChem CID 15793969) has the molecular formula C48H41Cl2N5OPtS and a molecular weight of 1001.94 g/mol. Its IUPAC name is dichloroplatinum;methylsulfinylmethane;5,10,20-tris(4-methylphenyl)-15-pyridin-4-yl-21,22-dihydroporphyrin.
| Compound Name | dichloroplatinum;methylsulfinylmethane;5,10,20-tris(4-methylphenyl)-15-pyridin-4-yl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 15793969 |
| Molecular Formula | C48H41Cl2N5OPtS |
| Molecular Weight | 1001.94 g/mol |
| Exact Mass | 1000.21 |
| IUPAC Name | dichloroplatinum;methylsulfinylmethane;5,10,20-tris(4-methylphenyl)-15-pyridin-4-yl-21,22-dihydroporphyrin |
| SMILES | CS(C)=O.Cc1ccc(-c2c3nc(c(-c4ccncc4)c4nc(c(-c5ccc(C)cc5)c5ccc([nH]5)c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1.Cl[Pt]Cl |
| InChI | InChI=1S/C46H35N5.C2H6OS.2ClH.Pt/c1-28-4-10-31(11-5-28)43-35-16-18-37(48-35)44(32-12-6-29(2)7-13-32)39-20-22-41(50-39)46(34-24-26-47-27-25-34)42-23-21-40(51-42)45(38-19-17-36(43)49-38)33-14-8-30(3)9-15-33;1-4(2)3;;;/h4-27,48-49H,1-3H3;1-2H3;2*1H;/q;;;;+2/p-2/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42-;;;; |
| InChIKey | CFSNXQQAQGOVMG-YPEXJPRUSA-L |
| XLogP | 13.02 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.94 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |