C49H53N4O9P3 — CID 136845604
5,10,15-tris(4-diethoxyphosphorylphenyl)-22,23-dihydro-21H-corrin (PubChem CID 136845604) has the molecular formula C49H53N4O9P3 and a molecular weight of 934.90 g/mol. Its IUPAC name is 5,10,15-tris(4-diethoxyphosphorylphenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(4-diethoxyphosphorylphenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 136845604 |
| Molecular Formula | C49H53N4O9P3 |
| Molecular Weight | 934.90 g/mol |
| Exact Mass | 934.30 |
| IUPAC Name | 5,10,15-tris(4-diethoxyphosphorylphenyl)-22,23-dihydro-21H-corrin |
| SMILES | CCOP(=O)(OCC)c1ccc(-c2c3nc(c4ccc([nH]4)c(-c4ccc(P(=O)(OCC)OCC)cc4)c4ccc([nH]4)c(-c4ccc(P(=O)(OCC)OCC)cc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C49H53N4O9P3/c1-7-57-63(54,58-8-2)36-19-13-33(14-20-36)47-41-27-25-39(50-41)40-26-28-42(51-40)48(34-15-21-37(22-16-34)64(55,59-9-3)60-10-4)44-30-32-46(53-44)49(45-31-29-43(47)52-45)35-17-23-38(24-18-35)65(56,61-11-5)62-12-6/h13-32,50,52-53H,7-12H2,1-6H3/b40-39-,47-41-,47-43-,48-42-,48-44-,49-45-,49-46- |
| InChIKey | DVEAPZHMHYCCBO-RPSMEDARSA-N |
| XLogP | 12.37 |
| TPSA | 166.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.90 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|