C64H78N4O8Si4 — CID 136846592
diethoxy-methyl-[4-[10,15,20-tris[4-[diethoxy(methyl)silyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]silane (PubChem CID 136846592) has the molecular formula C64H78N4O8Si4 and a molecular weight of 1143.69 g/mol. Its IUPAC name is diethoxy-methyl-[4-[10,15,20-tris[4-[diethoxy(methyl)silyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]silane.
| Compound Name | diethoxy-methyl-[4-[10,15,20-tris[4-[diethoxy(methyl)silyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]silane |
|---|---|
| PubChem CID | 136846592 |
| Molecular Formula | C64H78N4O8Si4 |
| Molecular Weight | 1143.69 g/mol |
| Exact Mass | 1142.49 |
| IUPAC Name | diethoxy-methyl-[4-[10,15,20-tris[4-[diethoxy(methyl)silyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]silane |
| SMILES | CCO[Si](C)(OCC)c1ccc(-c2c3nc(c(-c4ccc([Si](C)(OCC)OCC)cc4)c4ccc([nH]4)c(-c4ccc([Si](C)(OCC)OCC)cc4)c4nc(c(-c5ccc([Si](C)(OCC)OCC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C64H78N4O8Si4/c1-13-69-77(9,70-14-2)49-29-21-45(22-30-49)61-53-37-39-55(65-53)62(46-23-31-50(32-24-46)78(10,71-15-3)72-16-4)57-41-43-59(67-57)64(48-27-35-52(36-28-48)80(12,75-19-7)76-20-8)60-44-42-58(68-60)63(56-40-38-54(61)66-56)47-25-33-51(34-26-47)79(11,73-17-5)74-18-6/h21-44,65,68H,13-20H2,1-12H3/b61-53-,61-54-,62-55-,62-57-,63-56-,63-58-,64-59-,64-60- |
| InChIKey | MLJHEQDKIVZNQF-WJVFOVLXSA-N |
| XLogP | 12.73 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.69 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|