C72H78N4O4S4 — CID 135424303
S-[5-[4-[10,15,20-tris[4-(5-acetylsulfanylpentyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]pentyl] ethanethioate (PubChem CID 135424303) has the molecular formula C72H78N4O4S4 and a molecular weight of 1191.71 g/mol. Its IUPAC name is S-[5-[4-[10,15,20-tris[4-(5-acetylsulfanylpentyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]pentyl] ethanethioate.
| Compound Name | S-[5-[4-[10,15,20-tris[4-(5-acetylsulfanylpentyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]pentyl] ethanethioate |
|---|---|
| PubChem CID | 135424303 |
| Molecular Formula | C72H78N4O4S4 |
| Molecular Weight | 1191.71 g/mol |
| Exact Mass | 1190.49 |
| IUPAC Name | S-[5-[4-[10,15,20-tris[4-(5-acetylsulfanylpentyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]pentyl] ethanethioate |
| SMILES | CC(=O)SCCCCCc1ccc(-c2c3nc(c(-c4ccc(CCCCCSC(C)=O)cc4)c4ccc([nH]4)c(-c4ccc(CCCCCSC(C)=O)cc4)c4nc(c(-c5ccc(CCCCCSC(C)=O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C72H78N4O4S4/c1-49(77)81-45-13-5-9-17-53-21-29-57(30-22-53)69-61-37-39-63(73-61)70(58-31-23-54(24-32-58)18-10-6-14-46-82-50(2)78)65-41-43-67(75-65)72(60-35-27-56(28-36-60)20-12-8-16-48-84-52(4)80)68-44-42-66(76-68)71(64-40-38-62(69)74-64)59-33-25-55(26-34-59)19-11-7-15-47-83-51(3)79/h21-44,73,76H,5-20,45-48H2,1-4H3/b69-61-,69-62-,70-63-,70-65-,71-64-,71-66-,72-67-,72-68- |
| InChIKey | DXCDTXROFKCOSU-CIILXYKUSA-N |
| XLogP | 19.29 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1191.71 |
| LogP ≤ 5 | 19.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|