C50H40BrIN4 — CID 10920069
15-(4-bromophenyl)-5-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 10920069) has the molecular formula C50H40BrIN4 and a molecular weight of 903.71 g/mol. Its IUPAC name is 15-(4-bromophenyl)-5-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 15-(4-bromophenyl)-5-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10920069 |
| Molecular Formula | C50H40BrIN4 |
| Molecular Weight | 903.71 g/mol |
| Exact Mass | 902.15 |
| IUPAC Name | 15-(4-bromophenyl)-5-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4ccc(Br)cc4)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc([nH]5)c(-c5ccc(I)cc5)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C50H40BrIN4/c1-27-23-29(3)45(30(4)24-27)49-41-19-15-37(53-41)47(33-7-11-35(51)12-8-33)38-16-20-42(54-38)50(46-31(5)25-28(2)26-32(46)6)44-22-18-40(56-44)48(39-17-21-43(49)55-39)34-9-13-36(52)14-10-34/h7-26,55-56H,1-6H3/b47-37-,47-38-,48-39-,48-40-,49-41+,49-43+,50-42+,50-44+ |
| InChIKey | DOJAYLLGGSRZQC-RKVFKSQOSA-N |
| XLogP | 14.54 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.71 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|