C28H30N4V — CID 159214384
5,10,15,20-tetraethyl-21,22-dihydroporphyrin;vanadium (PubChem CID 159214384) has the molecular formula C28H30N4V and a molecular weight of 473.52 g/mol. Its IUPAC name is 5,10,15,20-tetraethyl-21,22-dihydroporphyrin;vanadium.
| Compound Name | 5,10,15,20-tetraethyl-21,22-dihydroporphyrin;vanadium |
|---|---|
| PubChem CID | 159214384 |
| Molecular Formula | C28H30N4V |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 5,10,15,20-tetraethyl-21,22-dihydroporphyrin;vanadium |
| SMILES | CCc1c2nc(c(CC)c3ccc([nH]3)c(CC)c3ccc([nH]3)c(CC)c3nc1C=C3)C=C2.[V] |
| InChI | InChI=1S/C28H30N4.V/c1-5-17-21-9-11-23(29-21)18(6-2)25-13-15-27(31-25)20(8-4)28-16-14-26(32-28)19(7-3)24-12-10-22(17)30-24;/h9-16,29-30H,5-8H2,1-4H3;/b21-17-,22-17-,23-18-,24-19-,25-18-,26-19-,27-20-,28-20-; |
| InChIKey | APCLNQYYIMCWIB-QYXUKJHESA-N |
| XLogP | 6.90 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |