C48H42N8 — CID 102403895
4-[[10,15,20-tris[(4-aminophenyl)methyl]-21,24-dihydroporphyrin-5-yl]methyl]aniline (PubChem CID 102403895) has the molecular formula C48H42N8 and a molecular weight of 730.92 g/mol. Its IUPAC name is 4-[[10,15,20-tris[(4-aminophenyl)methyl]-21,24-dihydroporphyrin-5-yl]methyl]aniline.
| Compound Name | 4-[[10,15,20-tris[(4-aminophenyl)methyl]-21,24-dihydroporphyrin-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 102403895 |
| Molecular Formula | C48H42N8 |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | 4-[[10,15,20-tris[(4-aminophenyl)methyl]-21,24-dihydroporphyrin-5-yl]methyl]aniline |
| SMILES | Nc1ccc(Cc2c3nc(c(Cc4ccc(N)cc4)c4ccc([nH]4)c(Cc4ccc(N)cc4)c4ccc([nH]4)c(Cc4ccc(N)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H42N8/c49-33-9-1-29(2-10-33)25-37-41-17-19-43(53-41)38(26-30-3-11-34(50)12-4-30)45-21-23-47(55-45)40(28-32-7-15-36(52)16-8-32)48-24-22-46(56-48)39(44-20-18-42(37)54-44)27-31-5-13-35(51)14-6-31/h1-24,53-54H,25-28,49-52H2/b41-37-,42-37-,43-38-,44-39-,45-38-,46-39-,47-40-,48-40- |
| InChIKey | AYQVKGMBPLZBKA-ZEZJBKRTSA-N |
| XLogP | 9.35 |
| TPSA | 161.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|