C52H66N12+4 — CID 10234790
5,10,15,20-tetrakis[(1,3-diethylimidazol-1-ium-2-yl)methyl]-21,22-dihydroporphyrin (PubChem CID 10234790) has the molecular formula C52H66N12+4 and a molecular weight of 859.18 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[(1,3-diethylimidazol-1-ium-2-yl)methyl]-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[(1,3-diethylimidazol-1-ium-2-yl)methyl]-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10234790 |
| Molecular Formula | C52H66N12+4 |
| Molecular Weight | 859.18 g/mol |
| Exact Mass | 858.55 |
| IUPAC Name | 5,10,15,20-tetrakis[(1,3-diethylimidazol-1-ium-2-yl)methyl]-21,22-dihydroporphyrin |
| SMILES | CCn1cc[n+](CC)c1Cc1c2nc(c(Cc3n(CC)cc[n+]3CC)c3ccc([nH]3)c(Cc3n(CC)cc[n+]3CC)c3ccc([nH]3)c(Cc3n(CC)cc[n+]3CC)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C52H66N12/c1-9-57-25-26-58(10-2)49(57)33-37-41-17-19-43(53-41)38(34-50-59(11-3)27-28-60(50)12-4)45-21-23-47(55-45)40(36-52-63(15-7)31-32-64(52)16-8)48-24-22-46(56-48)39(44-20-18-42(37)54-44)35-51-61(13-5)29-30-62(51)14-6/h17-32,53-54H,9-16,33-36H2,1-8H3/q+4/b41-37-,42-37-,43-38-,44-39-,45-38-,46-39-,47-40-,48-40- |
| InChIKey | UDACUOVQNDQZHA-ZEZJBKRTSA-N |
| XLogP | 7.53 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.18 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|