C20H10B4N4 — CID 25195400
5,10,15,20-Tetraborylporphyrin (PubChem CID 25195400) has the molecular formula C20H10B4N4 and a molecular weight of 349.58 g/mol.
| Compound Name | 5,10,15,20-Tetraborylporphyrin |
|---|---|
| PubChem CID | 25195400 |
| Molecular Formula | C20H10B4N4 |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | — |
| SMILES | [B]c1c2nc(c([B])c3ccc([nH]3)c([B])c3ccc([nH]3)c([B])c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C20H10B4N4/c21-17-9-1-2-10(25-9)18(22)12-5-6-14(27-12)20(24)16-8-7-15(28-16)19(23)13-4-3-11(17)26-13/h1-8,25-26H/b17-9+,17-11+,18-10+,18-12+,19-13+,19-15+,20-14+,20-16+ |
| InChIKey | CLYKYEJJUMNBJF-OTHQCIQNSA-N |
| XLogP | -0.17 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|