C19H11Al3N4 — CID 144685388
CID 144685388 (PubChem CID 144685388) has the molecular formula C19H11Al3N4 and a molecular weight of 376.27 g/mol.
| Compound Name | CID 144685388 |
|---|---|
| PubChem CID | 144685388 |
| Molecular Formula | C19H11Al3N4 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | — |
| SMILES | [Al]c1c2nc(c([Al])c3ccc([nH]3)c3ccc([nH]3)c([Al])c3ccc1[nH]3)C=C2 |
| InChI | InChI=1S/C19H11N4.3Al/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14;;;/h1-8,20,22-23H;;;/b12-9?,13-9?,14-10?,15-11?,16-10?,17-11?,19-18-;;; |
| InChIKey | ZPHBHYHIQHETGP-XPPOMNILSA-N |
| XLogP | 1.08 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |