C37H20Br6N4 — CID 137266912
5,10,15-tris(2,6-dibromophenyl)-22,23-dihydro-21H-corrin (PubChem CID 137266912) has the molecular formula C37H20Br6N4 and a molecular weight of 1000.02 g/mol. Its IUPAC name is 5,10,15-tris(2,6-dibromophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(2,6-dibromophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 137266912 |
| Molecular Formula | C37H20Br6N4 |
| Molecular Weight | 1000.02 g/mol |
| Exact Mass | 993.68 |
| IUPAC Name | 5,10,15-tris(2,6-dibromophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Brc1cccc(Br)c1-c1c2nc(c3ccc([nH]3)c(-c3c(Br)cccc3Br)c3ccc([nH]3)c(-c3c(Br)cccc3Br)c3ccc1[nH]3)C=C2 |
| InChI | InChI=1S/C37H20Br6N4/c38-18-4-1-5-19(39)32(18)35-26-12-10-24(44-26)25-11-13-27(45-25)36(33-20(40)6-2-7-21(33)41)29-15-17-31(47-29)37(30-16-14-28(35)46-30)34-22(42)8-3-9-23(34)43/h1-17,44,46-47H/b25-24-,35-26+,35-28+,36-27+,36-29+,37-30+,37-31+ |
| InChIKey | QSLYPEADKWQUEF-QKUKPUCPSA-N |
| XLogP | 14.27 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.02 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |