C56H54Br8N4Si4 — CID 167499514
[3,5-dibromo-4-[10,15,20-tris(2,6-dibromo-4-trimethylsilylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]-trimethylsilane (PubChem CID 167499514) has the molecular formula C56H54Br8N4Si4 and a molecular weight of 1534.65 g/mol. Its IUPAC name is [3,5-dibromo-4-[10,15,20-tris(2,6-dibromo-4-trimethylsilylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]-trimethylsilane.
| Compound Name | [3,5-dibromo-4-[10,15,20-tris(2,6-dibromo-4-trimethylsilylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 167499514 |
| Molecular Formula | C56H54Br8N4Si4 |
| Molecular Weight | 1534.65 g/mol |
| Exact Mass | 1525.69 |
| IUPAC Name | [3,5-dibromo-4-[10,15,20-tris(2,6-dibromo-4-trimethylsilylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc(Br)c(-c2c3nc(c(-c4c(Br)cc([Si](C)(C)C)cc4Br)c4ccc([nH]4)c(-c4c(Br)cc([Si](C)(C)C)cc4Br)c4nc(c(-c5c(Br)cc([Si](C)(C)C)cc5Br)c5ccc2[nH]5)C=C4)C=C3)c(Br)c1 |
| InChI | InChI=1S/C56H54Br8N4Si4/c1-69(2,3)29-21-33(57)49(34(58)22-29)53-41-13-15-43(65-41)54(50-35(59)23-30(24-36(50)60)70(4,5)6)45-17-19-47(67-45)56(52-39(63)27-32(28-40(52)64)72(10,11)12)48-20-18-46(68-48)55(44-16-14-42(53)66-44)51-37(61)25-31(26-38(51)62)71(7,8)9/h13-28,65,68H,1-12H3/b53-41+,53-42+,54-43+,54-45+,55-44+,55-46+,56-47+,56-48+ |
| InChIKey | LVWCHBJUPLVUFQ-RNWYWIMESA-N |
| XLogP | 19.60 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1534.65 |
| LogP ≤ 5 | 19.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|