C30H28N4S — CID 177438322
5,10,15-triethyl-20-thiophen-3-yl-21,22-dihydroporphyrin (PubChem CID 177438322) has the molecular formula C30H28N4S and a molecular weight of 476.65 g/mol. Its IUPAC name is 5,10,15-triethyl-20-thiophen-3-yl-21,22-dihydroporphyrin.
| Compound Name | 5,10,15-triethyl-20-thiophen-3-yl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 177438322 |
| Molecular Formula | C30H28N4S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 5,10,15-triethyl-20-thiophen-3-yl-21,22-dihydroporphyrin |
| SMILES | CCc1c2nc(c(CC)c3ccc([nH]3)c(CC)c3ccc([nH]3)c(-c3ccsc3)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C30H28N4S/c1-4-19-22-7-9-24(31-22)20(5-2)26-11-13-28(33-26)30(18-15-16-35-17-18)29-14-12-27(34-29)21(6-3)25-10-8-23(19)32-25/h7-17,31,33H,4-6H2,1-3H3/b22-19-,23-19-,24-20-,25-21-,26-20-,27-21-,30-28-,30-29- |
| InChIKey | RAZOCXNHNUUOAV-SYDRDBPQSA-N |
| XLogP | 8.07 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |