C42H46I2N6S2 — CID 135475461
trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethylsulfanyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethyl]azanium diiodide (PubChem CID 135475461) has the molecular formula C42H46I2N6S2 and a molecular weight of 952.81 g/mol. Its IUPAC name is trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethylsulfanyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethyl]azanium diiodide.
| Compound Name | trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethylsulfanyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethyl]azanium diiodide |
|---|---|
| PubChem CID | 135475461 |
| Molecular Formula | C42H46I2N6S2 |
| Molecular Weight | 952.81 g/mol |
| Exact Mass | 952.13 |
| IUPAC Name | trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethylsulfanyl]phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]sulfanylethyl]azanium diiodide |
| SMILES | C[N+](C)(C)CCSc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(SCC[N+](C)(C)C)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1.[I-].[I-] |
| InChI | InChI=1S/C42H46N6S2.2HI/c1-47(2,3)23-25-49-35-15-7-29(8-16-35)41-37-19-11-31(43-37)27-33-13-21-39(45-33)42(30-9-17-36(18-10-30)50-26-24-48(4,5)6)40-22-14-34(46-40)28-32-12-20-38(41)44-32;;/h7-22,27-28,43,46H,23-26H2,1-6H3;2*1H/q+2;;/p-2/b31-27-,32-28-,33-27-,34-28-,41-37-,41-38-,42-39-,42-40-;; |
| InChIKey | GQCPJOGGBCHHJR-HHJVBWMWSA-L |
| XLogP | 3.59 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|