C50H46I2N6O2 — CID 11766527
trimethyl-[3-[4-[15-[4-[3-(trimethylazaniumyl)phenoxy]phenyl]-21,22-dihydroporphyrin-5-yl]phenoxy]phenyl]azanium diiodide (PubChem CID 11766527) has the molecular formula C50H46I2N6O2 and a molecular weight of 1016.77 g/mol. Its IUPAC name is trimethyl-[3-[4-[15-[4-[3-(trimethylazaniumyl)phenoxy]phenyl]-21,22-dihydroporphyrin-5-yl]phenoxy]phenyl]azanium diiodide.
| Compound Name | trimethyl-[3-[4-[15-[4-[3-(trimethylazaniumyl)phenoxy]phenyl]-21,22-dihydroporphyrin-5-yl]phenoxy]phenyl]azanium diiodide |
|---|---|
| PubChem CID | 11766527 |
| Molecular Formula | C50H46I2N6O2 |
| Molecular Weight | 1016.77 g/mol |
| Exact Mass | 1016.18 |
| IUPAC Name | trimethyl-[3-[4-[15-[4-[3-(trimethylazaniumyl)phenoxy]phenyl]-21,22-dihydroporphyrin-5-yl]phenoxy]phenyl]azanium diiodide |
| SMILES | C[N+](C)(C)c1cccc(Oc2ccc(-c3c4nc(cc5ccc([nH]5)c(-c5ccc(Oc6cccc([N+](C)(C)C)c6)cc5)c5ccc(cc6nc3C=C6)[nH]5)C=C4)cc2)c1.[I-].[I-] |
| InChI | InChI=1S/C50H46N6O2.2HI/c1-55(2,3)39-9-7-11-43(31-39)57-41-21-13-33(14-22-41)49-45-25-17-35(51-45)29-37-19-27-47(53-37)50(48-28-20-38(54-48)30-36-18-26-46(49)52-36)34-15-23-42(24-16-34)58-44-12-8-10-40(32-44)56(4,5)6;;/h7-32,51-52H,1-6H3;2*1H/q+2;;/p-2/b35-29-,36-30-,37-29-,38-30-,49-45-,49-46-,50-47-,50-48-;; |
| InChIKey | RHVJANOBHHLNIJ-JPDDOSBNSA-L |
| XLogP | 5.98 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|