C38H22Cl4N12 — CID 10865650
4,6-dichloro-N-[4-[15-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]-21,22-dihydroporphyrin-5-yl]phenyl]-1,3,5-triazin-2-amine (PubChem CID 10865650) has the molecular formula C38H22Cl4N12 and a molecular weight of 788.49 g/mol. Its IUPAC name is 4,6-dichloro-N-[4-[15-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]-21,22-dihydroporphyrin-5-yl]phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-[4-[15-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]-21,22-dihydroporphyrin-5-yl]phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 10865650 |
| Molecular Formula | C38H22Cl4N12 |
| Molecular Weight | 788.49 g/mol |
| Exact Mass | 786.08 |
| IUPAC Name | 4,6-dichloro-N-[4-[15-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]-21,22-dihydroporphyrin-5-yl]phenyl]-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(Nc2ccc(-c3c4nc(cc5ccc([nH]5)c(-c5ccc(Nc6nc(Cl)nc(Cl)n6)cc5)c5ccc(cc6nc3C=C6)[nH]5)C=C4)cc2)n1 |
| InChI | InChI=1S/C38H22Cl4N12/c39-33-49-34(40)52-37(51-33)47-21-5-1-19(2-6-21)31-27-13-9-23(43-27)17-25-11-15-29(45-25)32(30-16-12-26(46-30)18-24-10-14-28(31)44-24)20-3-7-22(8-4-20)48-38-53-35(41)50-36(42)54-38/h1-18,43-44H,(H,47,49,51,52)(H,48,50,53,54)/b23-17-,24-18-,25-17-,26-18-,31-27-,31-28-,32-29-,32-30- |
| InChIKey | JBZVKSYBMXVJHK-DICHWLPUSA-N |
| XLogP | 10.46 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.49 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |