C55H58N4O2 — CID 136825623
2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 136825623) has the molecular formula C55H58N4O2 and a molecular weight of 807.10 g/mol. Its IUPAC name is 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 136825623 |
| Molecular Formula | C55H58N4O2 |
| Molecular Weight | 807.10 g/mol |
| Exact Mass | 806.46 |
| IUPAC Name | 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc(cc5nc(c(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c6ccc2[nH]6)C=C5)[nH]4)C=C3)=CC1=O |
| InChI | InChI=1S/C55H58N4O2/c1-31-22-48(61)40(30-47(31)60)51-45-20-18-43(58-45)49(32-23-34(52(2,3)4)27-35(24-32)53(5,6)7)41-16-14-38(56-41)29-39-15-17-42(57-39)50(44-19-21-46(51)59-44)33-25-36(54(8,9)10)28-37(26-33)55(11,12)13/h14-30,56,59H,1-13H3/b38-29-,39-29-,49-41-,49-43-,50-42-,50-44-,51-45-,51-46- |
| InChIKey | SJSBOTFGSAXCBP-QSLGSPGESA-N |
| XLogP | 13.66 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.10 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|