C56H55Cl2N5O2 — CID 136765107
2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5,6-dichloroisoindole-1,3-dione (PubChem CID 136765107) has the molecular formula C56H55Cl2N5O2 and a molecular weight of 900.99 g/mol. Its IUPAC name is 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5,6-dichloroisoindole-1,3-dione.
| Compound Name | 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5,6-dichloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 136765107 |
| Molecular Formula | C56H55Cl2N5O2 |
| Molecular Weight | 900.99 g/mol |
| Exact Mass | 899.37 |
| IUPAC Name | 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-5,6-dichloroisoindole-1,3-dione |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(N4C(=O)c5cc(Cl)c(Cl)cc5C4=O)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C56H55Cl2N5O2/c1-53(2,3)32-21-30(22-33(25-32)54(4,5)6)48-42-15-13-36(59-42)27-37-14-16-43(60-37)49(31-23-34(55(7,8)9)26-35(24-31)56(10,11)12)45-18-20-47(62-45)50(46-19-17-44(48)61-46)63-51(64)38-28-40(57)41(58)29-39(38)52(63)65/h13-29,59,62H,1-12H3/b36-27-,37-27-,48-42-,48-44-,49-43-,49-45-,50-46+,50-47+ |
| InChIKey | APONAYCEBGSTFF-QYEKJRLYSA-N |
| XLogP | 15.29 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.99 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|