C52H58N4O2 — CID 136731640
1-[8-acetyl-5,15-bis(3,5-ditert-butylphenyl)-22,24-dihydroporphyrin-2-yl]ethanone (PubChem CID 136731640) has the molecular formula C52H58N4O2 and a molecular weight of 771.06 g/mol. Its IUPAC name is 1-[8-acetyl-5,15-bis(3,5-ditert-butylphenyl)-22,24-dihydroporphyrin-2-yl]ethanone.
| Compound Name | 1-[8-acetyl-5,15-bis(3,5-ditert-butylphenyl)-22,24-dihydroporphyrin-2-yl]ethanone |
|---|---|
| PubChem CID | 136731640 |
| Molecular Formula | C52H58N4O2 |
| Molecular Weight | 771.06 g/mol |
| Exact Mass | 770.46 |
| IUPAC Name | 1-[8-acetyl-5,15-bis(3,5-ditert-butylphenyl)-22,24-dihydroporphyrin-2-yl]ethanone |
| SMILES | CC(=O)C1=Cc2nc1cc1ccc([nH]1)c(-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1nc(cc3[nH]c(cc3C(C)=O)c2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C=C1 |
| InChI | InChI=1S/C52H58N4O2/c1-29(57)39-27-45-48(32-21-35(51(9,10)11)24-36(22-32)52(12,13)14)46-28-40(30(2)58)44(56-46)26-38-16-18-42(54-38)47(41-17-15-37(53-41)25-43(39)55-45)31-19-33(49(3,4)5)23-34(20-31)50(6,7)8/h15-28,53,56H,1-14H3/b37-25-,38-26-,43-25-,44-26-,47-41-,47-42-,48-45-,48-46- |
| InChIKey | UPIOFQJUNLXQIF-AZZISLPMSA-N |
| XLogP | 13.34 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.06 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |