C60H65N5O2 — CID 136707692
2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-4,5,6,7-tetramethylisoindole-1,3-dione (PubChem CID 136707692) has the molecular formula C60H65N5O2 and a molecular weight of 888.21 g/mol. Its IUPAC name is 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-4,5,6,7-tetramethylisoindole-1,3-dione.
| Compound Name | 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-4,5,6,7-tetramethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 136707692 |
| Molecular Formula | C60H65N5O2 |
| Molecular Weight | 888.21 g/mol |
| Exact Mass | 887.51 |
| IUPAC Name | 2-[10,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]-4,5,6,7-tetramethylisoindole-1,3-dione |
| SMILES | Cc1c(C)c(C)c2c(c1C)C(=O)N(c1c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc(cc5nc(c(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c6ccc1[nH]6)C=C5)[nH]4)C=C3)C2=O |
| InChI | InChI=1S/C60H65N5O2/c1-32-33(2)35(4)51-50(34(32)3)55(66)65(56(51)67)54-48-23-21-46(63-48)52(36-25-38(57(5,6)7)29-39(26-36)58(8,9)10)44-19-17-42(61-44)31-43-18-20-45(62-43)53(47-22-24-49(54)64-47)37-27-40(59(11,12)13)30-41(28-37)60(14,15)16/h17-31,61,64H,1-16H3/b42-31-,43-31-,52-44-,52-46-,53-45-,53-47-,54-48+,54-49+ |
| InChIKey | UCADMGJKDBOAJI-CJXGIPDTSA-N |
| XLogP | 15.21 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.21 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|