C40H39N5 — CID 136683333
10,20-bis(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-amine (PubChem CID 136683333) has the molecular formula C40H39N5 and a molecular weight of 589.79 g/mol. Its IUPAC name is 10,20-bis(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-amine.
| Compound Name | 10,20-bis(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-amine |
|---|---|
| PubChem CID | 136683333 |
| Molecular Formula | C40H39N5 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | 10,20-bis(4-tert-butylphenyl)-21,23-dihydroporphyrin-5-amine |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(N)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C40H39N5/c1-39(2,3)26-11-7-24(8-12-26)36-30-17-15-28(42-30)23-29-16-18-31(43-29)37(25-9-13-27(14-10-25)40(4,5)6)33-20-22-35(45-33)38(41)34-21-19-32(36)44-34/h7-23,42,45H,41H2,1-6H3/b28-23-,29-23-,36-30-,36-32-,37-31-,37-33-,38-34+,38-35+ |
| InChIKey | UETIPRSGHWYMCA-VPNBPQRDSA-N |
| XLogP | 10.17 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |