C43H40N4O — CID 136744608
15,20-bis(4-tert-butylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene (PubChem CID 136744608) has the molecular formula C43H40N4O and a molecular weight of 628.82 g/mol. Its IUPAC name is 15,20-bis(4-tert-butylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene.
| Compound Name | 15,20-bis(4-tert-butylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene |
|---|---|
| PubChem CID | 136744608 |
| Molecular Formula | C43H40N4O |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | 15,20-bis(4-tert-butylphenyl)-25-oxa-24,26,27,28-tetrazahexacyclo[19.2.1.12,5.17,10.111,14.116,19]octacosa-1,3,5,7(27),8,10,12,14,16,18,20,22-dodecaene |
| SMILES | CC(C)(C)c1ccc(-c2c3ccc([nH]3)c3nc(cc4ccc([nH]4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4ccc2o4)C=C3)cc1 |
| InChI | InChI=1S/C43H40N4O/c1-42(2,3)28-11-7-26(8-12-28)40-36-21-19-34(46-36)32-17-15-30(44-32)25-31-16-18-33(45-31)35-20-22-37(47-35)41(39-24-23-38(40)48-39)27-9-13-29(14-10-27)43(4,5)6/h7-25,44,46-47H,1-6H3/b30-25-,31-25-,34-32-,35-33-,40-36-,40-38-,41-37-,41-39- |
| InChIKey | PNVIMKPBNMUHHE-SJFCWUQQSA-N |
| XLogP | 11.93 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |