C50H45AlN4 — CID 174615325
alumane;5,7,8-triethyl-10,12,13,23-tetraphenyl-21H-porphyrin (PubChem CID 174615325) has the molecular formula C50H45AlN4 and a molecular weight of 728.92 g/mol. Its IUPAC name is alumane;5,7,8-triethyl-10,12,13,23-tetraphenyl-21H-porphyrin.
| Compound Name | alumane;5,7,8-triethyl-10,12,13,23-tetraphenyl-21H-porphyrin |
|---|---|
| PubChem CID | 174615325 |
| Molecular Formula | C50H45AlN4 |
| Molecular Weight | 728.92 g/mol |
| Exact Mass | 728.35 |
| IUPAC Name | alumane;5,7,8-triethyl-10,12,13,23-tetraphenyl-21H-porphyrin |
| SMILES | CCC1=C(CC)c2nc1c(CC)c1ccc(cc3nc(cc4c(-c5ccccc5)c(-c5ccccc5)c(c2-c2ccccc2)n4-c2ccccc2)C=C3)[nH]1.[AlH3] |
| InChI | InChI=1S/C50H42N4.Al.3H/c1-4-40-41(5-2)49-47(35-23-15-9-16-24-35)50-46(34-21-13-8-14-22-34)45(33-19-11-7-12-20-33)44(54(50)39-25-17-10-18-26-39)32-38-28-27-36(51-38)31-37-29-30-43(52-37)42(6-3)48(40)53-49;;;;/h7-32,52H,4-6H2,1-3H3;;;;/b36-31-,37-31-,38-32-,43-42-,44-32-,48-42-,49-47-,50-47-;;;; |
| InChIKey | QPTKEHXORMUZJD-QDDPDQCISA-N |
| XLogP | 12.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.92 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |