C24H16N4 — CID 58823276
25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13(26),14,16,18(25),19,21,23-tridecaene (PubChem CID 58823276) has the molecular formula C24H16N4 and a molecular weight of 360.42 g/mol. Its IUPAC name is 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13(26),14,16,18(25),19,21,23-tridecaene.
| Compound Name | 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13(26),14,16,18(25),19,21,23-tridecaene |
|---|---|
| PubChem CID | 58823276 |
| Molecular Formula | C24H16N4 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1,3,5,7,9,11,13(26),14,16,18(25),19,21,23-tridecaene |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)-c1ccccc1-5)[nH]4)[nH]3 |
| InChI | InChI=1S/C24H16N4/c1-2-4-22-21(3-1)23-13-19-9-7-17(26-19)11-15-5-6-16(25-15)12-18-8-10-20(27-18)14-24(22)28-23/h1-14,25-26H/b15-11-,16-12-,17-11-,18-12-,19-13-,20-14-,23-13-,24-14- |
| InChIKey | SWBKMSNQWVRJHK-QSONDJRLSA-N |
| XLogP | 5.82 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |