C40H32N6O3 — CID 136727719
ethyl 2-[15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136727719) has the molecular formula C40H32N6O3 and a molecular weight of 644.74 g/mol. Its IUPAC name is ethyl 2-[15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 2-[15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136727719 |
| Molecular Formula | C40H32N6O3 |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | ethyl 2-[15-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1c2nc(cc3ccc([nH]3)c(-c3cnn(Cc4ccc(OC)cc4)c3)c3nc(cc4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C40H32N6O3/c1-3-49-40(47)33-7-5-4-6-32(33)39-36-18-12-29(44-36)20-27-10-16-34(42-27)38(35-17-11-28(43-35)21-30-13-19-37(39)45-30)26-22-41-46(24-26)23-25-8-14-31(48-2)15-9-25/h4-22,24,42,45H,3,23H2,1-2H3/b27-20-,28-21-,29-20-,30-21-,38-34-,38-35-,39-36-,39-37- |
| InChIKey | VINTVOKHAQXFHT-MWYCPEBMSA-N |
| XLogP | 8.42 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |